ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103986-73-8 3-Ethoxycinnamic acid |
|
Nama produk | 3-Ethoxycinnamic acid |
Nama Inggeris | 3-Ethoxycinnamic acid;3-Ethoxycinnamic acid,predominantly trans;trans-3-Ethoxycinnamic acid;(2E)-3-(3-ethoxyphenyl)prop-2-enoic acid |
MF | C11H12O3 |
Berat Molekul | 192.2112 |
InChI | InChI=1/C11H12O3/c1-2-14-10-5-3-4-9(8-10)6-7-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b7-6+ |
CAS NO | 103986-73-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.161g/cm3 |
Titik didih | 341.6°C at 760 mmHg |
Indeks bias | 1.579 |
Titik nyala | 133.8°C |
Tekanan wap | 3.06E-05mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |