Chemindex > 103986-73-8
NO ▼
103986-73-8 3-Ethoxycinnamic acid |
|
| produktnavn | 3-Ethoxycinnamic acid |
| Engelsk navn | 3-Ethoxycinnamic acid;3-Ethoxycinnamic acid,predominantly trans;trans-3-Ethoxycinnamic acid;(2E)-3-(3-ethoxyphenyl)prop-2-enoic acid |
| Molekylær Formel | C11H12O3 |
| Molekylvekt | 192.2112 |
| InChI | InChI=1/C11H12O3/c1-2-14-10-5-3-4-9(8-10)6-7-11(12)13/h3-8H,2H2,1H3,(H,12,13)/b7-6+ |
| CAS-nummer | 103986-73-8 |
| Molecular Structure |  |
| Tetthet | 1.161g/cm3 |
| Kokepunkt | 341.6°C at 760 mmHg |
| Brytningsindeks | 1.579 |
| Flammepunktet | 133.8°C |
| Damptrykk | 3.06E-05mmHg at 25°C |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 103986-73-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 