ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106114-42-5 3-N-(2-fluoroethyl)spiperone |
|
| Nama produk | 3-N-(2-fluoroethyl)spiperone |
| Sinonim | 3-(2-fluoroethyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one; FESP, Fluoroethylspiperone; Fluoroethyl-spiperone |
| Nama Inggeris | 3-N-(2-fluoroethyl)spiperone;3-(2-fluoroethyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one;FESP, Fluoroethylspiperone;Fluoroethyl-spiperone |
| MF | C25H29F2N3O2 |
| Berat Molekul | 441.5135 |
| InChI | InChI=1/C25H29F2N3O2/c26-14-18-29-19-30(22-5-2-1-3-6-22)25(24(29)32)12-16-28(17-13-25)15-4-7-23(31)20-8-10-21(27)11-9-20/h1-3,5-6,8-11H,4,7,12-19H2 |
| CAS NO | 106114-42-5 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.27g/cm3 |
| Titik didih | 631.9°C at 760 mmHg |
| Indeks bias | 1.605 |
| Titik nyala | 336°C |
| Tekanan wap | 7.06E-16mmHg at 25°C |
| MSDS | |