ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106114-42-5 3-N- (2-floroetil) spiperon |
|
| Ürün Adı | 3-N- (2-floroetil) spiperon |
| Eş anlamlı | 3- (2-floroetil) -8 - [4- (4-florofenil) -4-oksobütil] -1-fenil-1,3,8-triazaspiro [4.5] dekan-4-on; FESP, Floroetilspiperon; Floroetil-spiperon |
| ingilizce adı | 3-N-(2-fluoroethyl)spiperone;3-(2-fluoroethyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one;FESP, Fluoroethylspiperone;Fluoroethyl-spiperone |
| Moleküler Formülü | C25H29F2N3O2 |
| Molekül Ağırlığı | 441.5135 |
| InChI | InChI=1/C25H29F2N3O2/c26-14-18-29-19-30(22-5-2-1-3-6-22)25(24(29)32)12-16-28(17-13-25)15-4-7-23(31)20-8-10-21(27)11-9-20/h1-3,5-6,8-11H,4,7,12-19H2 |
| CAS kayıt numarası | 106114-42-5 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.27g/cm3 |
| Kaynama noktası | 631.9°C at 760 mmHg |
| Kırılma indisi | 1.605 |
| Alevlenme noktası | 336°C |
| Buhar basıncı | 7.06E-16mmHg at 25°C |
| MSDS | |