Chemindex >132741-30-1
MY ▼
132741-30-1 2,4-difluoromandelic acid |
|
| Nama produk | 2,4-difluoromandelic acid |
| Nama Inggeris | 2,4-difluoromandelic acid;alpha-Hydroxy-2,4-difluorophenylacetic acid;2,4-difluoro mandelic acid;(2,4-difluorophenyl)(hydroxy)acetic acid;(2S)-(2,4-difluorophenyl)(hydroxy)ethanoate;(2R)-(2,4-difluorophenyl)(hydroxy)ethanoate |
| MF | C8H5F2O3 |
| Berat Molekul | 187.1209 |
| InChI | InChI=1/C8H6F2O3/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
| CAS NO | 132741-30-1 |
| Struktur Molekul |  |
| Titik didih | 306.5°C at 760 mmHg |
| Titik nyala | 139.1°C |
| Tekanan wap | 0.000336mmHg at 25°C |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 