ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
132741-30-1 2,4-difluoromandelic acid |
|
produktnavn | 2,4-difluoromandelic acid |
Engelsk navn | 2,4-difluoromandelic acid;alpha-Hydroxy-2,4-difluorophenylacetic acid;2,4-difluoro mandelic acid;(2,4-difluorophenyl)(hydroxy)acetic acid;(2S)-(2,4-difluorophenyl)(hydroxy)ethanoate;(2R)-(2,4-difluorophenyl)(hydroxy)ethanoate |
Molekylær Formel | C8H5F2O3 |
Molekylvekt | 187.1209 |
InChI | InChI=1/C8H6F2O3/c9-4-1-2-5(6(10)3-4)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
CAS-nummer | 132741-30-1 |
Molecular Structure | ![]() |
Kokepunkt | 306.5°C at 760 mmHg |
Flammepunktet | 139.1°C |
Damptrykk | 0.000336mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |