ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219928-36-6 2-{4-[(5-nitro-2-pyridyl)oxy]phenyl}acetonitrile |
|
Nama produk | 2-{4-[(5-nitro-2-pyridyl)oxy]phenyl}acetonitrile |
Sinonim | {4-[(5-nitropyridin-2-yl)oxy]phenyl}acetonitrile; |
Nama Inggeris | 2-{4-[(5-nitro-2-pyridyl)oxy]phenyl}acetonitrile;{4-[(5-nitropyridin-2-yl)oxy]phenyl}acetonitrile |
MF | C13H9N3O3 |
Berat Molekul | 255.2289 |
InChI | InChI=1/C13H9N3O3/c14-8-7-10-1-4-12(5-2-10)19-13-6-3-11(9-15-13)16(17)18/h1-6,9H,7H2 |
CAS NO | 219928-36-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.334g/cm3 |
Titik lebur | 118℃ |
Titik didih | 428.7°C at 760 mmHg |
Indeks bias | 1.615 |
Titik nyala | 213°C |
Tekanan wap | 1.49E-07mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |