ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219928-36-6 2-{4-[(5-nitro-2-pyridyl)oxy]fenyl}acetonitril |
|
produktnavn | 2-{4-[(5-nitro-2-pyridyl)oxy]fenyl}acetonitril |
Synonymer | {4-[(5-nitropyridin-2-yl)oxy]fenyl}acetonitril; |
Engelsk navn | 2-{4-[(5-nitro-2-pyridyl)oxy]phenyl}acetonitrile;{4-[(5-nitropyridin-2-yl)oxy]phenyl}acetonitrile |
Molekylær Formel | C13H9N3O3 |
Molekylvekt | 255.2289 |
InChI | InChI=1/C13H9N3O3/c14-8-7-10-1-4-12(5-2-10)19-13-6-3-11(9-15-13)16(17)18/h1-6,9H,7H2 |
CAS-nummer | 219928-36-6 |
Molecular Structure | ![]() |
Tetthet | 1.334g/cm3 |
Smeltepunkt | 118℃ |
Kokepunkt | 428.7°C at 760 mmHg |
Brytningsindeks | 1.615 |
Flammepunktet | 213°C |
Damptrykk | 1.49E-07mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |