ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-96-3 5-(2-thienyl)asid nikotinik |
|
Nama produk | 5-(2-thienyl)asid nikotinik |
Sinonim | 5-thiophen-2-ylpyridine-3-asid karboksilik; |
Nama Inggeris | 5-(2-thienyl)nicotinic acid;5-thiophen-2-ylpyridine-3-carboxylic acid |
MF | C10H7NO2S |
Berat Molekul | 205.2331 |
InChI | InChI=1/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13) |
CAS NO | 306934-96-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.368g/cm3 |
Titik lebur | 277℃ |
Titik didih | 423.8°C at 760 mmHg |
Indeks bias | 1.643 |
Titik nyala | 210.1°C |
Tekanan wap | 6.12E-08mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |