ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-96-3 5-(2-tienyl)nikotinsyre |
|
produktnavn | 5-(2-tienyl)nikotinsyre |
Synonymer | 5-tiofen-2-ylpyridin-3-karboksylsyre; |
Engelsk navn | 5-(2-thienyl)nicotinic acid;5-thiophen-2-ylpyridine-3-carboxylic acid |
Molekylær Formel | C10H7NO2S |
Molekylvekt | 205.2331 |
InChI | InChI=1/C10H7NO2S/c12-10(13)8-4-7(5-11-6-8)9-2-1-3-14-9/h1-6H,(H,12,13) |
CAS-nummer | 306934-96-3 |
Molecular Structure | ![]() |
Tetthet | 1.368g/cm3 |
Smeltepunkt | 277℃ |
Kokepunkt | 423.8°C at 760 mmHg |
Brytningsindeks | 1.643 |
Flammepunktet | 210.1°C |
Damptrykk | 6.12E-08mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |