ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-94-0 3-Nitrobenzhydrazide |
|
Nama produk | 3-Nitrobenzhydrazide |
Nama Inggeris | 3-Nitrobenzhydrazide;3-nitrobenzohydrazide;m-Nitrobenzhydrazide;3-Nitrobenzoylhydrazine |
MF | C7H7N3O3 |
Berat Molekul | 181.1488 |
InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
CAS NO | 618-94-0 |
EINECS | 210-572-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.406g/cm3 |
Titik lebur | 153-154℃ |
Indeks bias | 1.621 |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |