ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-94-0 3-Nitrobenzhydrazide |
|
Naam product | 3-Nitrobenzhydrazide |
Engelse naam | 3-Nitrobenzhydrazide;3-nitrobenzohydrazide;m-Nitrobenzhydrazide;3-Nitrobenzoylhydrazine |
MF | C7H7N3O3 |
Molecuulgewicht | 181.1488 |
InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
CAS-nummer | 618-94-0 |
EINECS | 210-572-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.406g/cm3 |
Smeltpunt | 153-154℃ |
Brekingsindex | 1.621 |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |