ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-70-1 butoxycarbonylmethyl butyl phthalate |
|
| Nama produk | butoxycarbonylmethyl butyl phthalate |
| Sinonim | ; butyl phthalyl butyl glycollate; n-Butyl phtalyl n-butyl glycoate; 2-butoxy-2-oxoethyl butyl benzene-1,2-dicarboxylate; |
| Nama Inggeris | butoxycarbonylmethyl butyl phthalate;butyl phthalyl butyl glycollate;n-Butyl phtalyl n-butyl glycoate;2-butoxy-2-oxoethyl butyl benzene-1,2-dicarboxylate |
| MF | C18H24O6 |
| Berat Molekul | 336.3796 |
| InChI | InChI=1/C18H24O6/c1-3-5-11-22-16(19)13-24-18(21)15-10-8-7-9-14(15)17(20)23-12-6-4-2/h7-10H,3-6,11-13H2,1-2H3 |
| CAS NO | 85-70-1 |
| EINECS | 201-624-8 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.118g/cm3 |
| Titik didih | 428.4°C at 760 mmHg |
| Indeks bias | 1.501 |
| Titik nyala | 185.5°C |
| Tekanan wap | 1.52E-07mmHg at 25°C |
| MSDS | |