ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-70-1 butoxycarbonylmethylbutylftalaat |
|
| Naam product | butoxycarbonylmethylbutylftalaat |
| Synoniemen | butylftalylbutylglycollaat; n-Butyl ftalyl n-butylglycoaat; 2-butoxy-2-oxoethylbutylbenzeen-1,2-dicarboxylaat; |
| Engelse naam | butoxycarbonylmethyl butyl phthalate;butyl phthalyl butyl glycollate;n-Butyl phtalyl n-butyl glycoate;2-butoxy-2-oxoethyl butyl benzene-1,2-dicarboxylate |
| MF | C18H24O6 |
| Molecuulgewicht | 336.3796 |
| InChI | InChI=1/C18H24O6/c1-3-5-11-22-16(19)13-24-18(21)15-10-8-7-9-14(15)17(20)23-12-6-4-2/h7-10H,3-6,11-13H2,1-2H3 |
| CAS-nummer | 85-70-1 |
| EINECS | 201-624-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.118g/cm3 |
| Kookpunt | 428.4°C at 760 mmHg |
| Brekingsindex | 1.501 |
| Vlampunt | 185.5°C |
| Dampdruk | 1.52E-07mmHg at 25°C |
| MSDS | |