ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
|
Nama produk | Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
Nama Inggeris | Methyl-2-chloro-6-methylpyrimidine-4-carboxylate;Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
MF | C7H7ClN2O2 |
Berat Molekul | 186.5957 |
InChI | InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
CAS NO | 89793-11-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.314g/cm3 |
Titik lebur | 107℃ |
Titik didih | 306.5°C at 760 mmHg |
Indeks bias | 1.53 |
Titik nyala | 139.2°C |
Tekanan wap | 0.000768mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |