ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
|
Ürün Adı | Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
ingilizce adı | Methyl-2-chloro-6-methylpyrimidine-4-carboxylate;Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
Moleküler Formülü | C7H7ClN2O2 |
Molekül Ağırlığı | 186.5957 |
InChI | InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
CAS kayıt numarası | 89793-11-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.314g/cm3 |
Ergime noktası | 107℃ |
Kaynama noktası | 306.5°C at 760 mmHg |
Kırılma indisi | 1.53 |
Alevlenme noktası | 139.2°C |
Buhar basıncı | 0.000768mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |