ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70092-43-2 pent-2-oxycyclohexaan-1-ol |
|
| Naam product | pent-2-oxycyclohexaan-1-ol |
| Synoniemen | Pent-2-oxycyclohexaan-1-ol; AI3-05917; Cyclohexanol, 2-(pentyloxy)-; 2-(pentyloxy)cyclohexanol; |
| Engelse naam | pent-2-oxycyclohexan-1-ol;Pent-2-oxycyclohexan-1-ol;AI3-05917;Cyclohexanol, 2-(pentyloxy)-;2-(pentyloxy)cyclohexanol |
| MF | C11H22O2 |
| Molecuulgewicht | 186.2912 |
| InChI | InChI=1/C11H22O2/c1-2-3-6-9-13-11-8-5-4-7-10(11)12/h10-12H,2-9H2,1H3 |
| CAS-nummer | 70092-43-2 |
| EINECS | 274-310-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.94g/cm3 |
| Kookpunt | 259.3°C at 760 mmHg |
| Brekingsindex | 1.462 |
| Vlampunt | 93.5°C |
| Dampdruk | 0.00191mmHg at 25°C |
| MSDS | |