ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70092-43-2 pent-2-oksisikloheksan-1-ol |
|
| Ürün Adı | pent-2-oksisikloheksan-1-ol |
| Eş anlamlı | Pent-2-oksisikloheksan-1-ol; AI3-05917; Sikloheksanol, 2- (pentiloksi) -; 2- (pentiloksi) sikloheksanol; |
| ingilizce adı | pent-2-oxycyclohexan-1-ol;Pent-2-oxycyclohexan-1-ol;AI3-05917;Cyclohexanol, 2-(pentyloxy)-;2-(pentyloxy)cyclohexanol |
| Moleküler Formülü | C11H22O2 |
| Molekül Ağırlığı | 186.2912 |
| InChI | InChI=1/C11H22O2/c1-2-3-6-9-13-11-8-5-4-7-10(11)12/h10-12H,2-9H2,1H3 |
| CAS kayıt numarası | 70092-43-2 |
| EINECS | 274-310-1 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 0.94g/cm3 |
| Kaynama noktası | 259.3°C at 760 mmHg |
| Kırılma indisi | 1.462 |
| Alevlenme noktası | 93.5°C |
| Buhar basıncı | 0.00191mmHg at 25°C |
| MSDS | |