ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72936-74-4 alpha-Pinene oxide |
|
Naam product | alpha-Pinene oxide |
Engelse naam | alpha-Pinene oxide;pin-2(3)-ene oxide;2,3-epoxypinane;(1S,6S)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane |
MF | C10H16O |
Molecuulgewicht | 152.2334 |
InChI | InChI=1/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8?,10?/m0/s1 |
CAS-nummer | 72936-74-4;1686-14-2;74525-43-2 |
EINECS | 216-869-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.027g/cm3 |
Kookpunt | 188.6°C at 760 mmHg |
Brekingsindex | 1.504 |
Vlampunt | 65.6°C |
Dampdruk | 0.819mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |