ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72936-74-4 alpha-Pinene oxide |
|
produktnavn | alpha-Pinene oxide |
Engelsk navn | alpha-Pinene oxide;pin-2(3)-ene oxide;2,3-epoxypinane;(1S,6S)-2,7,7-trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane |
Molekylær Formel | C10H16O |
Molekylvekt | 152.2334 |
InChI | InChI=1/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3/t6-,7-,8?,10?/m0/s1 |
CAS-nummer | 72936-74-4;1686-14-2;74525-43-2 |
EINECS | 216-869-6 |
Molecular Structure | ![]() |
Tetthet | 1.027g/cm3 |
Kokepunkt | 188.6°C at 760 mmHg |
Brytningsindeks | 1.504 |
Flammepunktet | 65.6°C |
Damptrykk | 0.819mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |