ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226717-83-5 2,3,5-trifluorobenzyl bromide |
|
| produktnavn | 2,3,5-trifluorobenzyl bromide |
| Engelsk navn | 2,3,5-trifluorobenzyl bromide;alpha-Bromo-2,3,5-trifluorotoluene;1-(bromomethyl)-2,3,5-trifluorobenzene |
| Molekylær Formel | C7H4BrF3 |
| Molekylvekt | 225.0059 |
| InChI | InChI=1/C7H4BrF3/c8-3-4-1-5(9)2-6(10)7(4)11/h1-2H,3H2 |
| CAS-nummer | 226717-83-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.71g/cm3 |
| Kokepunkt | 181.1°C at 760 mmHg |
| Brytningsindeks | 1.502 |
| Flammepunktet | 69.1°C |
| Damptrykk | 1.18mmHg at 25°C |
| Risiko Koder | R34##Causes burns.||R36##Irritating to eyes.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |