ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226717-83-5 2,3,5-trifluorobenzyl bromide |
|
| Nome do produto | 2,3,5-trifluorobenzyl bromide |
| Nome em inglês | 2,3,5-trifluorobenzyl bromide;alpha-Bromo-2,3,5-trifluorotoluene;1-(bromomethyl)-2,3,5-trifluorobenzene |
| Fórmula molecular | C7H4BrF3 |
| Peso Molecular | 225.0059 |
| InChI | InChI=1/C7H4BrF3/c8-3-4-1-5(9)2-6(10)7(4)11/h1-2H,3H2 |
| CAS Registry Number | 226717-83-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.71g/cm3 |
| Ponto de ebulição | 181.1°C at 760 mmHg |
| índice de refração | 1.502 |
| O ponto de inflamação | 69.1°C |
| Pressão de vapor | 1.18mmHg at 25°C |
| Códigos de risco | R34##Causes burns.||R36##Irritating to eyes.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |