ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
| produktnavn | Phenanthridine |
| Engelsk navn | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
| Molekylær Formel | C13H9N |
| Molekylvekt | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS-nummer | 229-87-8 |
| EINECS | 205-934-4 |
| Molecular Structure | ![]() |
| Tetthet | 1.187g/cm3 |
| Smeltepunkt | 104-107℃ |
| Kokepunkt | 340.8°C at 760 mmHg |
| Brytningsindeks | 1.726 |
| Flammepunktet | 155.9°C |
| Damptrykk | 0.000166mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R40##Possible risks of irreversible effects.:; |
| Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |