ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
| Nome do produto | Phenanthridine |
| Nome em inglês | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
| Fórmula molecular | C13H9N |
| Peso Molecular | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS Registry Number | 229-87-8 |
| EINECS | 205-934-4 |
| Estrutura Molecular | ![]() |
| Densidade | 1.187g/cm3 |
| Ponto de fusão | 104-107℃ |
| Ponto de ebulição | 340.8°C at 760 mmHg |
| índice de refração | 1.726 |
| O ponto de inflamação | 155.9°C |
| Pressão de vapor | 0.000166mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R40##Possible risks of irreversible effects.:; |
| Descrição da Segurança | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |