ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
304-91-6 2-iodosobenzoic acid moistened with water (H2O ~10%) |
|
| produktnavn | 2-iodosobenzoic acid moistened with water (H2O ~10%) |
| Engelsk navn | 2-iodosobenzoic acid moistened with water (H2O ~10%);o-Iodosobenzoic acid 2-Iodosobenzoic acid;Iodosobenzoicacid;2-iodosylbenzoic acid |
| Molekylær Formel | C7H5IO3 |
| Molekylvekt | 264.0173 |
| InChI | InChI=1/C7H5IO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4H,(H,9,10) |
| CAS-nummer | 304-91-6 |
| EINECS | 206-159-4 |
| Molecular Structure | ![]() |
| Smeltepunkt | 230℃ (dec.) |
| Hazard symboler | |
| Risiko Koder | R36/37/38:; |
| Sikkerhet Beskrivelse | S26||S36:; |
| MSDS | |