ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride |
|
produktnavn | 2,1,3-benzothiadiazole-5-carbonyl chloride |
Engelsk navn | 2,1,3-benzothiadiazole-5-carbonyl chloride; |
Molekylær Formel | C7H3ClN2OS |
Molekylvekt | 198.6295 |
InChI | InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H |
CAS-nummer | 321309-31-3 |
Molecular Structure | ![]() |
Tetthet | 1.577g/cm3 |
Smeltepunkt | 113℃ |
Kokepunkt | 297.6°C at 760 mmHg |
Brytningsindeks | 1.704 |
Flammepunktet | 133.8°C |
Damptrykk | 0.00133mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |