ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-31-3 2,1,3-benzothiadiazole-5-carbonyl chloride |
|
Ürün Adı | 2,1,3-benzothiadiazole-5-carbonyl chloride |
ingilizce adı | 2,1,3-benzothiadiazole-5-carbonyl chloride; |
Moleküler Formülü | C7H3ClN2OS |
Molekül Ağırlığı | 198.6295 |
InChI | InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-5-6(3-4)10-12-9-5/h1-3H |
CAS kayıt numarası | 321309-31-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.577g/cm3 |
Ergime noktası | 113℃ |
Kaynama noktası | 297.6°C at 760 mmHg |
Kırılma indisi | 1.704 |
Alevlenme noktası | 133.8°C |
Buhar basıncı | 0.00133mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |