ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
352018-96-3 4-(1H-pyrazol-1-yl)phenyl isothiocyanate |
|
| produktnavn | 4-(1H-pyrazol-1-yl)phenyl isothiocyanate |
| Engelsk navn | 4-(1H-pyrazol-1-yl)phenyl isothiocyanate;1-(4-isothiocyanatophenyl)-1H-pyrazole |
| Molekylær Formel | C10H7N3S |
| Molekylvekt | 201.2477 |
| InChI | InChI=1/C10H7N3S/c14-8-11-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H |
| CAS-nummer | 352018-96-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.21g/cm3 |
| Smeltepunkt | 97℃ |
| Kokepunkt | 342°C at 760 mmHg |
| Brytningsindeks | 1.657 |
| Flammepunktet | 160.6°C |
| Damptrykk | 0.000154mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |