ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
352018-96-3 4-(1H-pyrazol-1-yl)phenyl isothiocyanate |
|
| اسم المنتج | 4-(1H-pyrazol-1-yl)phenyl isothiocyanate |
| الاسم بالانجليزية | 4-(1H-pyrazol-1-yl)phenyl isothiocyanate;1-(4-isothiocyanatophenyl)-1H-pyrazole |
| الصيغة الجزيئية | C10H7N3S |
| الوزن الجزيئي الغرامي | 201.2477 |
| InChI | InChI=1/C10H7N3S/c14-8-11-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H |
| إستراتيجية المساعدة القطرية | 352018-96-3 |
| بنية جزيئية | ![]() |
| كثافة | 1.21g/cm3 |
| درجة الإنصهار | 97℃ |
| نقطة الغليان | 342°C at 760 mmHg |
| معامل الإنكسار | 1.657 |
| نقطة الوميض | 160.6°C |
| ضغط البخار | 0.000154mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |