ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-84-5 4-Fluoro-3-methylbenzoyl chloride |
|
| produktnavn | 4-Fluoro-3-methylbenzoyl chloride |
| Engelsk navn | 4-Fluoro-3-methylbenzoyl chloride;4-Fluoro-m-toluoyl chloride |
| Molekylær Formel | C8H6ClFO |
| Molekylvekt | 172.584 |
| InChI | InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
| CAS-nummer | 455-84-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.265g/cm3 |
| Kokepunkt | 214.1°C at 760 mmHg |
| Brytningsindeks | 1.518 |
| Flammepunktet | 83.3°C |
| Damptrykk | 0.158mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |