ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-84-5 4-Fluoro-3-methylbenzoyl chloride |
|
| Ürün Adı | 4-Fluoro-3-methylbenzoyl chloride |
| ingilizce adı | 4-Fluoro-3-methylbenzoyl chloride;4-Fluoro-m-toluoyl chloride |
| Moleküler Formülü | C8H6ClFO |
| Molekül Ağırlığı | 172.584 |
| InChI | InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
| CAS kayıt numarası | 455-84-5 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.265g/cm3 |
| Kaynama noktası | 214.1°C at 760 mmHg |
| Kırılma indisi | 1.518 |
| Alevlenme noktası | 83.3°C |
| Buhar basıncı | 0.158mmHg at 25°C |
| Risk Kodları | R34##Causes burns.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |