ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-32-6 Benzoyl bromide |
|
| produktnavn | Benzoyl bromide |
| Engelsk navn | Benzoyl bromide; |
| Molekylær Formel | C7H5BrO |
| Molekylvekt | 185.018 |
| InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| CAS-nummer | 618-32-6 |
| EINECS | 210-544-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.572g/cm3 |
| Smeltepunkt | -24℃ |
| Kokepunkt | 218.5°C at 760 mmHg |
| Brytningsindeks | 1.584 |
| Flammepunktet | 89.7°C |
| Damptrykk | 0.125mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |