ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-32-6 Benzoyl bromide |
|
| Nome do produto | Benzoyl bromide |
| Nome em inglês | Benzoyl bromide; |
| Fórmula molecular | C7H5BrO |
| Peso Molecular | 185.018 |
| InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| CAS Registry Number | 618-32-6 |
| EINECS | 210-544-2 |
| Estrutura Molecular | ![]() |
| Densidade | 1.572g/cm3 |
| Ponto de fusão | -24℃ |
| Ponto de ebulição | 218.5°C at 760 mmHg |
| índice de refração | 1.584 |
| O ponto de inflamação | 89.7°C |
| Pressão de vapor | 0.125mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; |
| Descrição da Segurança | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |