ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
108210-73-7 Bifeprofen |
|
| Nazwa produktu: | Bifeprofen |
| Angielska nazwa | Bifeprofen;Bifeprofen [INN];(+-)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methylpiperazine;UNII-9973I7EX5X;( -)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methyllpiperazine;2-(4-methylpiperazin-1-yl)-2-oxoethyl 2-(2'-chlorobiphenyl-4-yl)propanoate |
| MF | C22H25ClN2O3 |
| Masie cząsteczkowej | 400.8985 |
| InChI | InChI=1/C22H25ClN2O3/c1-16(22(27)28-15-21(26)25-13-11-24(2)12-14-25)17-7-9-18(10-8-17)19-5-3-4-6-20(19)23/h3-10,16H,11-15H2,1-2H3 |
| Nr CAS | 108210-73-7 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.209g/cm3 |
| Temperatura wrzenia | 543.8°C at 760 mmHg |
| Współczynnik załamania | 1.572 |
| Temperatura zapłonu | 282.7°C |
| Ciśnienie pary | 6.92E-12mmHg at 25°C |
| MSDS | |