ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
108210-73-7 Bifeprofen |
|
| Nome do produto | Bifeprofen |
| Nome em inglês | Bifeprofen;Bifeprofen [INN];(+-)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methylpiperazine;UNII-9973I7EX5X;( -)-2'-Chloro-alpha-methyl-4-biphenylacetic acid, ester with 1-glycoloyl-4-methyllpiperazine;2-(4-methylpiperazin-1-yl)-2-oxoethyl 2-(2'-chlorobiphenyl-4-yl)propanoate |
| Fórmula molecular | C22H25ClN2O3 |
| Peso Molecular | 400.8985 |
| InChI | InChI=1/C22H25ClN2O3/c1-16(22(27)28-15-21(26)25-13-11-24(2)12-14-25)17-7-9-18(10-8-17)19-5-3-4-6-20(19)23/h3-10,16H,11-15H2,1-2H3 |
| CAS Registry Number | 108210-73-7 |
| Estrutura Molecular | ![]() |
| Densidade | 1.209g/cm3 |
| Ponto de ebulição | 543.8°C at 760 mmHg |
| índice de refração | 1.572 |
| O ponto de inflamação | 282.7°C |
| Pressão de vapor | 6.92E-12mmHg at 25°C |
| MSDS | |