ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
244022-67-1 2,4-dibromo-6-fluorophenyl isothiocyanate |
|
| Nazwa produktu: | 2,4-dibromo-6-fluorophenyl isothiocyanate |
| Angielska nazwa | 2,4-dibromo-6-fluorophenyl isothiocyanate;1,5-dibromo-3-fluoro-2-isothiocyanatobenzene |
| MF | C7H2Br2FNS |
| Masie cząsteczkowej | 310.9689 |
| InChI | InChI=1/C7H2Br2FNS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| Nr CAS | 244022-67-1 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.96g/cm3 |
| Temperatura wrzenia | 328.4°C at 760 mmHg |
| Współczynnik załamania | 1.649 |
| Temperatura zapłonu | 152.4°C |
| Ciśnienie pary | 0.000364mmHg at 25°C |
| MSDS | |