ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
244022-67-1 2,4-dibromo-6-fluorophenyl isothiocyanate |
|
| Nome do produto | 2,4-dibromo-6-fluorophenyl isothiocyanate |
| Nome em inglês | 2,4-dibromo-6-fluorophenyl isothiocyanate;1,5-dibromo-3-fluoro-2-isothiocyanatobenzene |
| Fórmula molecular | C7H2Br2FNS |
| Peso Molecular | 310.9689 |
| InChI | InChI=1/C7H2Br2FNS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| CAS Registry Number | 244022-67-1 |
| Estrutura Molecular | ![]() |
| Densidade | 1.96g/cm3 |
| Ponto de ebulição | 328.4°C at 760 mmHg |
| índice de refração | 1.649 |
| O ponto de inflamação | 152.4°C |
| Pressão de vapor | 0.000364mmHg at 25°C |
| MSDS | |