ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
808769-20-2 4-[3-(aminomethyl)phenyl]phenol |
|
| Nome do produto | 4-[3-(aminomethyl)phenyl]phenol |
| Nome em inglês | 4-[3-(aminomethyl)phenyl]phenol;[1,1'-biphenyl]-4-ol, 3'-(aminomethyl)-;3'-(Aminomethyl)biphenyl-4-ol;3-(4-Hydroxyphenyl)Benzylamine |
| Fórmula molecular | C13H13NO |
| Peso Molecular | 199.2484 |
| InChI | InChI=1/C13H13NO/c14-9-10-2-1-3-12(8-10)11-4-6-13(15)7-5-11/h1-8,15H,9,14H2 |
| CAS Registry Number | 808769-20-2 |
| Estrutura Molecular | ![]() |
| Densidade | 1.151g/cm3 |
| Ponto de ebulição | 364.831°C at 760 mmHg |
| índice de refração | 1.625 |
| O ponto de inflamação | 174.444°C |
| Pressão de vapor | 0mmHg at 25°C |
| MSDS | |