ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
808769-20-2 4-[3-(aminomethyl)phenyl]phenol |
|
| Ürün Adı | 4-[3-(aminomethyl)phenyl]phenol |
| ingilizce adı | 4-[3-(aminomethyl)phenyl]phenol;[1,1'-biphenyl]-4-ol, 3'-(aminomethyl)-;3'-(Aminomethyl)biphenyl-4-ol;3-(4-Hydroxyphenyl)Benzylamine |
| Moleküler Formülü | C13H13NO |
| Molekül Ağırlığı | 199.2484 |
| InChI | InChI=1/C13H13NO/c14-9-10-2-1-3-12(8-10)11-4-6-13(15)7-5-11/h1-8,15H,9,14H2 |
| CAS kayıt numarası | 808769-20-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.151g/cm3 |
| Kaynama noktası | 364.831°C at 760 mmHg |
| Kırılma indisi | 1.625 |
| Alevlenme noktası | 174.444°C |
| Buhar basıncı | 0mmHg at 25°C |
| MSDS | |