ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4476-28-2 4-Isopropylphenylacetic acid |
|
| اسم المنتج | 4-Isopropylphenylacetic acid |
| الاسم بالانجليزية | 4-Isopropylphenylacetic acid;AI3-12008;Benzeneacetic acid, 4-(1-methylethyl)-;[4-(propan-2-yl)phenyl]acetic acid;[4-(1-methylethyl)phenyl]acetate |
| الصيغة الجزيئية | C11H13O2 |
| الوزن الجزيئي الغرامي | 177.2203 |
| InChI | InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| إستراتيجية المساعدة القطرية | 4476-28-2 |
| المفوضية الأوروبية رقم | 224-755-2 |
| بنية جزيئية | ![]() |
| نقطة الغليان | 295°C at 760 mmHg |
| نقطة الوميض | 192.1°C |
| ضغط البخار | 0.00071mmHg at 25°C |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |