ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4476-28-2 4-Isopropylphenylacetic acid |
|
| Ürün Adı | 4-Isopropylphenylacetic acid |
| ingilizce adı | 4-Isopropylphenylacetic acid;AI3-12008;Benzeneacetic acid, 4-(1-methylethyl)-;[4-(propan-2-yl)phenyl]acetic acid;[4-(1-methylethyl)phenyl]acetate |
| Moleküler Formülü | C11H13O2 |
| Molekül Ağırlığı | 177.2203 |
| InChI | InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| CAS kayıt numarası | 4476-28-2 |
| EINECS | 224-755-2 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 295°C at 760 mmHg |
| Alevlenme noktası | 192.1°C |
| Buhar basıncı | 0.00071mmHg at 25°C |
| Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |