ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1115-47-5 N-Acetyl-DL-methionine |
|
| Chemical Name | N-Acetyl-DL-methionine |
| Synonyms | Ac-DL-Met-OH;D.L Methionine N, acetyl;N-acetylmethionine;(2R)-2-(acetylamino)-4-(methylsulfanyl)butanoate |
| Molecular Formula | C7H12NO3S |
| Molecular Weight | 190.2406 |
| InChl | InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/p-1/t6-/m1/s1 |
| CAS Registry Number | 1115-47-5 |
| EINECS | 214-224-3 |
| Molecular Structure | ![]() |
| Melting Point | 117-119℃ |
| Boiling Point | 453.6°C at 760 mmHg |
| Flash Point | 228.1°C |
| Vapour Pressur | 1.72E-09mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |