ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37989-92-7 1-(2'-fluoro[1,1'-biphenyl]-4-yl)propan-1-one |
|
| Chemical Name | 1-(2'-fluoro[1,1'-biphenyl]-4-yl)propan-1-one |
| Synonyms | 1-(2'-fluorobiphenyl-4-yl)propan-1-one |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.2615 |
| InChl | InChI=1/C15H13FO/c1-2-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3 |
| CAS Registry Number | 37989-92-7 |
| Molecular Structure | ![]() |
| Density | 1.102g/cm3 |
| Boiling Point | 334.1°C at 760 mmHg |
| Refractive Index | 1.545 |
| Flash Point | 138.5°C |
| Vapour Pressur | 0.000131mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |