ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5444-08-6 6-[(4-methylphenyl)sulfanyl]-5H-purine |
|
| Chemical Name | 6-[(4-methylphenyl)sulfanyl]-5H-purine |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.2996 |
| InChl | InChI=1/C12H10N4S/c1-8-2-4-9(5-3-8)17-12-10-11(14-6-13-10)15-7-16-12/h2-7,10H,1H3 |
| CAS Registry Number | 5444-08-6 |
| Molecular Structure | ![]() |
| Density | 1.4g/cm3 |
| Boiling Point | 401.7°C at 760 mmHg |
| Refractive Index | 1.745 |
| Flash Point | 196.8°C |
| Vapour Pressur | 2.68E-06mmHg at 25°C |
| MSDS | |