ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
855-97-0 3',4',5,7-Tetramethoxyflavone |
|
| Chemical Name | 3',4',5,7-Tetramethoxyflavone |
| Synonyms | Luteolin tetramethyl ether;2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.3426 |
| InChl | InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
| CAS Registry Number | 855-97-0 |
| Molecular Structure | ![]() |
| Density | 1.243g/cm3 |
| Boiling Point | 528.8°C at 760 mmHg |
| Refractive Index | 1.574 |
| Flash Point | 233.9°C |
| Vapour Pressur | 2.86E-11mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |