ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-08-6 Methyl 2-acetamidobenzoate |
|
| Chemical Name | Methyl 2-acetamidobenzoate |
| Synonyms | methyl 2-(acetylamino)benzoate;Methyl N-acetylanthranilate;ACETYL-N-METHYL-ANTHRANILATE |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.1992 |
| InChl | InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
| CAS Registry Number | 2719-08-6 |
| EINECS | 220-318-5 |
| Molecular Structure | ![]() |
| Density | 1.204g/cm3 |
| Melting Point | 97-101℃ |
| Boiling Point | 376.3°C at 760 mmHg |
| Refractive Index | 1.565 |
| Flash Point | 181.4°C |
| Vapour Pressur | 7.3E-06mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |