ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27775-00-4 isononylamine, mixture of isomeric nonylamines |
|
Chemical Name | isononylamine, mixture of isomeric nonylamines |
Synonyms | Isononylamine;7-methyloctan-1-amine |
Molecular Formula | C9H21N |
Molecular Weight | 143.2697 |
InChl | InChI=1/C9H21N/c1-9(2)7-5-3-4-6-8-10/h9H,3-8,10H2,1-2H3 |
CAS Registry Number | 27775-00-4 |
EINECS | 248-653-2 |
Molecular Structure | ![]() |
Density | 0.79g/cm3 |
Boiling Point | 191°C at 760 mmHg |
Refractive Index | 1.434 |
Flash Point | 69.8°C |
Vapour Pressur | 0.526mmHg at 25°C |
MSDS |