ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27775-00-4 isononylamine, mixture of isomeric nonylamines |
|
produktnavn | isononylamine, mixture of isomeric nonylamines |
Engelsk navn | isononylamine, mixture of isomeric nonylamines;Isononylamine;7-methyloctan-1-amine |
Molekylær Formel | C9H21N |
Molekylvekt | 143.2697 |
InChI | InChI=1/C9H21N/c1-9(2)7-5-3-4-6-8-10/h9H,3-8,10H2,1-2H3 |
CAS-nummer | 27775-00-4 |
EINECS | 248-653-2 |
Molecular Structure | ![]() |
Tetthet | 0.79g/cm3 |
Kokepunkt | 191°C at 760 mmHg |
Brytningsindeks | 1.434 |
Flammepunktet | 69.8°C |
Damptrykk | 0.526mmHg at 25°C |
MSDS |