ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27775-00-4 isononylamine, mixture of isomeric nonylamines |
|
Produkt-Name | isononylamine, mixture of isomeric nonylamines |
Englischer Name | isononylamine, mixture of isomeric nonylamines;Isononylamine;7-methyloctan-1-amine |
Molekulare Formel | C9H21N |
Molecular Weight | 143.2697 |
InChl | InChI=1/C9H21N/c1-9(2)7-5-3-4-6-8-10/h9H,3-8,10H2,1-2H3 |
CAS Registry Number | 27775-00-4 |
EINECS | 248-653-2 |
Molecular Structure | ![]() |
Dichte | 0.79g/cm3 |
Siedepunkt | 191°C at 760 mmHg |
Brechungsindex | 1.434 |
Flammpunkt | 69.8°C |
Dampfdruck | 0.526mmHg at 25°C |
MSDS |