ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-31-4 Desyl chloride |
|
| Chemical Name | Desyl chloride |
| Synonyms | alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.6895 |
| InChl | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| CAS Registry Number | 447-31-4 |
| EINECS | 207-181-7 |
| Molecular Structure | ![]() |
| Density | 1.19g/cm3 |
| Melting Point | 65-69℃ |
| Boiling Point | 345.5°C at 760 mmHg |
| Refractive Index | 1.592 |
| Flash Point | 190.4°C |
| Vapour Pressur | 6.14E-05mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
| Safety Description | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
| MSDS | |